C12H15N3O — CID 80510752
5,6-diethyl-3-prop-2-enoxypyridazine-4-carbonitrile (PubChem CID 80510752) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 5,6-diethyl-3-prop-2-enoxypyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-prop-2-enoxypyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80510752 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 5,6-diethyl-3-prop-2-enoxypyridazine-4-carbonitrile |
| SMILES | C=CCOc1nnc(CC)c(CC)c1C#N |
| InChI | InChI=1S/C12H15N3O/c1-4-7-16-12-10(8-13)9(5-2)11(6-3)14-15-12/h4H,1,5-7H2,2-3H3 |
| InChIKey | OSSUOCPZHJRRNN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|