C31H35N3O3S2 — CID 139751686
4-(2-aminophenyl)sulfanyl-5-(3-methoxyphenyl)sulfanyl-3,6-dipentoxybenzene-1,2-dicarbonitrile (PubChem CID 139751686) has the molecular formula C31H35N3O3S2 and a molecular weight of 561.77 g/mol. Its IUPAC name is 4-(2-aminophenyl)sulfanyl-5-(3-methoxyphenyl)sulfanyl-3,6-dipentoxybenzene-1,2-dicarbonitrile.
| Compound Name | 4-(2-aminophenyl)sulfanyl-5-(3-methoxyphenyl)sulfanyl-3,6-dipentoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139751686 |
| Molecular Formula | C31H35N3O3S2 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | 4-(2-aminophenyl)sulfanyl-5-(3-methoxyphenyl)sulfanyl-3,6-dipentoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCOc1c(C#N)c(C#N)c(OCCCCC)c(Sc2ccccc2N)c1Sc1cccc(OC)c1 |
| InChI | InChI=1S/C31H35N3O3S2/c1-4-6-10-17-36-28-24(20-32)25(21-33)29(37-18-11-7-5-2)31(39-27-16-9-8-15-26(27)34)30(28)38-23-14-12-13-22(19-23)35-3/h8-9,12-16,19H,4-7,10-11,17-18,34H2,1-3H3 |
| InChIKey | PQZKCFHVILVUAV-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|