C35H43N3O2S2 — CID 139751634
4-(2-aminophenyl)sulfanyl-3,6-dipentoxy-5-(4-pentylphenyl)sulfanylbenzene-1,2-dicarbonitrile (PubChem CID 139751634) has the molecular formula C35H43N3O2S2 and a molecular weight of 601.88 g/mol. Its IUPAC name is 4-(2-aminophenyl)sulfanyl-3,6-dipentoxy-5-(4-pentylphenyl)sulfanylbenzene-1,2-dicarbonitrile.
| Compound Name | 4-(2-aminophenyl)sulfanyl-3,6-dipentoxy-5-(4-pentylphenyl)sulfanylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139751634 |
| Molecular Formula | C35H43N3O2S2 |
| Molecular Weight | 601.88 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 4-(2-aminophenyl)sulfanyl-3,6-dipentoxy-5-(4-pentylphenyl)sulfanylbenzene-1,2-dicarbonitrile |
| SMILES | CCCCCOc1c(C#N)c(C#N)c(OCCCCC)c(Sc2ccccc2N)c1Sc1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C35H43N3O2S2/c1-4-7-10-15-26-18-20-27(21-19-26)41-34-32(39-22-13-8-5-2)28(24-36)29(25-37)33(40-23-14-9-6-3)35(34)42-31-17-12-11-16-30(31)38/h11-12,16-21H,4-10,13-15,22-23,38H2,1-3H3 |
| InChIKey | CFGZQMWOLMXSJB-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.88 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|