C24H30ClN5O2S — CID 139694396
4-(2-aminophenyl)sulfanyl-5-chloro-3,6-bis[3-(dimethylamino)propoxy]benzene-1,2-dicarbonitrile (PubChem CID 139694396) has the molecular formula C24H30ClN5O2S and a molecular weight of 488.06 g/mol. Its IUPAC name is 4-(2-aminophenyl)sulfanyl-5-chloro-3,6-bis[3-(dimethylamino)propoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2-aminophenyl)sulfanyl-5-chloro-3,6-bis[3-(dimethylamino)propoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139694396 |
| Molecular Formula | C24H30ClN5O2S |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 4-(2-aminophenyl)sulfanyl-5-chloro-3,6-bis[3-(dimethylamino)propoxy]benzene-1,2-dicarbonitrile |
| SMILES | CN(C)CCCOc1c(Cl)c(Sc2ccccc2N)c(OCCCN(C)C)c(C#N)c1C#N |
| InChI | InChI=1S/C24H30ClN5O2S/c1-29(2)11-7-13-31-22-17(15-26)18(16-27)23(32-14-8-12-30(3)4)24(21(22)25)33-20-10-6-5-9-19(20)28/h5-6,9-10H,7-8,11-14,28H2,1-4H3 |
| InChIKey | USBPIUJYVZCNAH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|