C22H27ClN4O4S — CID 18699115
6-(2-aminophenyl)sulfanyl-5-chloro-4,7-bis(2-ethoxyethoxy)-3-iminoisoindol-1-amine (PubChem CID 18699115) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is 6-(2-aminophenyl)sulfanyl-5-chloro-4,7-bis(2-ethoxyethoxy)-3-iminoisoindol-1-amine.
| Compound Name | 6-(2-aminophenyl)sulfanyl-5-chloro-4,7-bis(2-ethoxyethoxy)-3-iminoisoindol-1-amine |
|---|---|
| PubChem CID | 18699115 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 6-(2-aminophenyl)sulfanyl-5-chloro-4,7-bis(2-ethoxyethoxy)-3-iminoisoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2c(OCCOCC)c(Sc3ccccc3N)c(Cl)c(OCCOCC)c21 |
| InChI | InChI=1S/C22H27ClN4O4S/c1-3-28-9-11-30-18-15-16(22(26)27-21(15)25)19(31-12-10-29-4-2)20(17(18)23)32-14-8-6-5-7-13(14)24/h5-8H,3-4,9-12,24H2,1-2H3,(H3,25,26,27) |
| InChIKey | HACVQTZBHKOSRK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|