C26H35FN4O2S — CID 18699099
6-(2-aminophenyl)sulfanyl-5-fluoro-4,7-dihexoxy-3-iminoisoindol-1-amine (PubChem CID 18699099) has the molecular formula C26H35FN4O2S and a molecular weight of 486.66 g/mol. Its IUPAC name is 6-(2-aminophenyl)sulfanyl-5-fluoro-4,7-dihexoxy-3-iminoisoindol-1-amine.
| Compound Name | 6-(2-aminophenyl)sulfanyl-5-fluoro-4,7-dihexoxy-3-iminoisoindol-1-amine |
|---|---|
| PubChem CID | 18699099 |
| Molecular Formula | C26H35FN4O2S |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 6-(2-aminophenyl)sulfanyl-5-fluoro-4,7-dihexoxy-3-iminoisoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2c(OCCCCCC)c(Sc3ccccc3N)c(F)c(OCCCCCC)c21 |
| InChI | InChI=1S/C26H35FN4O2S/c1-3-5-7-11-15-32-22-19-20(26(30)31-25(19)29)23(33-16-12-8-6-4-2)24(21(22)27)34-18-14-10-9-13-17(18)28/h9-10,13-14H,3-8,11-12,15-16,28H2,1-2H3,(H3,29,30,31) |
| InChIKey | PDZVHWFPKUEDTP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|