C28H39ClN4O2S — CID 18699069
6-(2-aminophenyl)sulfanyl-5-chloro-3-imino-4,7-bis(5-methylhexoxy)isoindol-1-amine (PubChem CID 18699069) has the molecular formula C28H39ClN4O2S and a molecular weight of 531.17 g/mol. Its IUPAC name is 6-(2-aminophenyl)sulfanyl-5-chloro-3-imino-4,7-bis(5-methylhexoxy)isoindol-1-amine.
| Compound Name | 6-(2-aminophenyl)sulfanyl-5-chloro-3-imino-4,7-bis(5-methylhexoxy)isoindol-1-amine |
|---|---|
| PubChem CID | 18699069 |
| Molecular Formula | C28H39ClN4O2S |
| Molecular Weight | 531.17 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 6-(2-aminophenyl)sulfanyl-5-chloro-3-imino-4,7-bis(5-methylhexoxy)isoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2c(OCCCCC(C)C)c(Sc3ccccc3N)c(Cl)c(OCCCCC(C)C)c21 |
| InChI | InChI=1S/C28H39ClN4O2S/c1-17(2)11-7-9-15-34-24-21-22(28(32)33-27(21)31)25(35-16-10-8-12-18(3)4)26(23(24)29)36-20-14-6-5-13-19(20)30/h5-6,13-14,17-18H,7-12,15-16,30H2,1-4H3,(H3,31,32,33) |
| InChIKey | RHSYYRWJDQCJAB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.17 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|