C18H32ClN5O+2 — CID 7211016
[amino-[[3-chloro-4-(7-methyloctoxy)phenyl]methylazaniumylidene]methyl]-(diaminomethylidene)azanium (PubChem CID 7211016) has the molecular formula C18H32ClN5O+2 and a molecular weight of 369.94 g/mol. Its IUPAC name is [amino-[[3-chloro-4-(7-methyloctoxy)phenyl]methylazaniumylidene]methyl]-(diaminomethylidene)azanium.
| Compound Name | [amino-[[3-chloro-4-(7-methyloctoxy)phenyl]methylazaniumylidene]methyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 7211016 |
| Molecular Formula | C18H32ClN5O+2 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [amino-[[3-chloro-4-(7-methyloctoxy)phenyl]methylazaniumylidene]methyl]-(diaminomethylidene)azanium |
| SMILES | CC(C)CCCCCCOc1ccc(C/[NH+]=C(\N)[NH+]=C(N)N)cc1Cl |
| InChI | InChI=1S/C18H30ClN5O/c1-13(2)7-5-3-4-6-10-25-16-9-8-14(11-15(16)19)12-23-18(22)24-17(20)21/h8-9,11,13H,3-7,10,12H2,1-2H3,(H6,20,21,22,23,24)/p+2 |
| InChIKey | CHGFTOAEZOEWJK-UHFFFAOYSA-P |
| XLogP | -0.43 |
| TPSA | 115.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|