C13H22ClN3O5S — CID 44661962
[3-chloro-4-(3-methylbutoxy)phenyl]methyl-(diaminomethylidene)azanium;hydrogen sulfate (PubChem CID 44661962) has the molecular formula C13H22ClN3O5S and a molecular weight of 367.86 g/mol. Its IUPAC name is [3-chloro-4-(3-methylbutoxy)phenyl]methyl-(diaminomethylidene)azanium;hydrogen sulfate.
| Compound Name | [3-chloro-4-(3-methylbutoxy)phenyl]methyl-(diaminomethylidene)azanium;hydrogen sulfate |
|---|---|
| PubChem CID | 44661962 |
| Molecular Formula | C13H22ClN3O5S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [3-chloro-4-(3-methylbutoxy)phenyl]methyl-(diaminomethylidene)azanium;hydrogen sulfate |
| SMILES | CC(C)CCOc1ccc(C[NH+]=C(N)N)cc1Cl.O=S(=O)([O-])O |
| InChI | InChI=1S/C13H20ClN3O.H2O4S/c1-9(2)5-6-18-12-4-3-10(7-11(12)14)8-17-13(15)16;1-5(2,3)4/h3-4,7,9H,5-6,8H2,1-2H3,(H4,15,16,17);(H2,1,2,3,4) |
| InChIKey | COOFMMFUWYLRFE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|