C21H27ClN2OS — CID 3754308
1-[[3-chloro-4-(5-methylhexoxy)phenyl]methyl]-3-phenylthiourea (PubChem CID 3754308) has the molecular formula C21H27ClN2OS and a molecular weight of 390.98 g/mol. Its IUPAC name is 1-[[3-chloro-4-(5-methylhexoxy)phenyl]methyl]-3-phenylthiourea.
| Compound Name | 1-[[3-chloro-4-(5-methylhexoxy)phenyl]methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3754308 |
| Molecular Formula | C21H27ClN2OS |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-[[3-chloro-4-(5-methylhexoxy)phenyl]methyl]-3-phenylthiourea |
| SMILES | CC(C)CCCCOc1ccc(CNC(=S)Nc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H27ClN2OS/c1-16(2)8-6-7-13-25-20-12-11-17(14-19(20)22)15-23-21(26)24-18-9-4-3-5-10-18/h3-5,9-12,14,16H,6-8,13,15H2,1-2H3,(H2,23,24,26) |
| InChIKey | VKJANHXTGIEUPY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|