C18H21ClN2OS — CID 823221
1-[[3-chloro-4-(2-methylpropoxy)phenyl]methyl]-3-phenylthiourea (PubChem CID 823221) has the molecular formula C18H21ClN2OS and a molecular weight of 348.90 g/mol. Its IUPAC name is 1-[[3-chloro-4-(2-methylpropoxy)phenyl]methyl]-3-phenylthiourea.
| Compound Name | 1-[[3-chloro-4-(2-methylpropoxy)phenyl]methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 823221 |
| Molecular Formula | C18H21ClN2OS |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-[[3-chloro-4-(2-methylpropoxy)phenyl]methyl]-3-phenylthiourea |
| SMILES | CC(C)COc1ccc(CNC(=S)Nc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2OS/c1-13(2)12-22-17-9-8-14(10-16(17)19)11-20-18(23)21-15-6-4-3-5-7-15/h3-10,13H,11-12H2,1-2H3,(H2,20,21,23) |
| InChIKey | ZZVUMPFJBBQVDQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|