C34H42N4O2S2 — CID 139751732
4-(2-aminophenyl)sulfanyl-5-[3-(diethylamino)phenyl]sulfanyl-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile (PubChem CID 139751732) has the molecular formula C34H42N4O2S2 and a molecular weight of 602.87 g/mol. Its IUPAC name is 4-(2-aminophenyl)sulfanyl-5-[3-(diethylamino)phenyl]sulfanyl-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2-aminophenyl)sulfanyl-5-[3-(diethylamino)phenyl]sulfanyl-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139751732 |
| Molecular Formula | C34H42N4O2S2 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 4-(2-aminophenyl)sulfanyl-5-[3-(diethylamino)phenyl]sulfanyl-3,6-bis(3-methylbutoxy)benzene-1,2-dicarbonitrile |
| SMILES | CCN(CC)c1cccc(Sc2c(OCCC(C)C)c(C#N)c(C#N)c(OCCC(C)C)c2Sc2ccccc2N)c1 |
| InChI | InChI=1S/C34H42N4O2S2/c1-7-38(8-2)25-12-11-13-26(20-25)41-33-31(39-18-16-23(3)4)27(21-35)28(22-36)32(40-19-17-24(5)6)34(33)42-30-15-10-9-14-29(30)37/h9-15,20,23-24H,7-8,16-19,37H2,1-6H3 |
| InChIKey | ZJGCMBNPJLUAQV-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|