C26H33N3O2S2 — CID 139751704
4-(2-aminophenyl)sulfanyl-5-butylsulfanyl-3,6-bis(2-methylpropoxy)benzene-1,2-dicarbonitrile (PubChem CID 139751704) has the molecular formula C26H33N3O2S2 and a molecular weight of 483.70 g/mol. Its IUPAC name is 4-(2-aminophenyl)sulfanyl-5-butylsulfanyl-3,6-bis(2-methylpropoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2-aminophenyl)sulfanyl-5-butylsulfanyl-3,6-bis(2-methylpropoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139751704 |
| Molecular Formula | C26H33N3O2S2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 4-(2-aminophenyl)sulfanyl-5-butylsulfanyl-3,6-bis(2-methylpropoxy)benzene-1,2-dicarbonitrile |
| SMILES | CCCCSc1c(OCC(C)C)c(C#N)c(C#N)c(OCC(C)C)c1Sc1ccccc1N |
| InChI | InChI=1S/C26H33N3O2S2/c1-6-7-12-32-25-23(30-15-17(2)3)19(13-27)20(14-28)24(31-16-18(4)5)26(25)33-22-11-9-8-10-21(22)29/h8-11,17-18H,6-7,12,15-16,29H2,1-5H3 |
| InChIKey | PYYKFVFXUATKQI-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|