C22H24O2 — CID 102394428
2,3-dibutoxy-1,4-diethynylnaphthalene (PubChem CID 102394428) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2,3-dibutoxy-1,4-diethynylnaphthalene.
| Compound Name | 2,3-dibutoxy-1,4-diethynylnaphthalene |
|---|---|
| PubChem CID | 102394428 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2,3-dibutoxy-1,4-diethynylnaphthalene |
| SMILES | C#Cc1c(OCCCC)c(OCCCC)c(C#C)c2ccccc12 |
| InChI | InChI=1S/C22H24O2/c1-5-9-15-23-21-17(7-3)19-13-11-12-14-20(19)18(8-4)22(21)24-16-10-6-2/h3-4,11-14H,5-6,9-10,15-16H2,1-2H3 |
| InChIKey | QZTPBXBFNUBGFQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|