C15H15ClN2O3 — CID 62496011
2-chloro-6-(2,6-dimethoxyphenoxy)benzenecarboximidamide (PubChem CID 62496011) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-chloro-6-(2,6-dimethoxyphenoxy)benzenecarboximidamide.
| Compound Name | 2-chloro-6-(2,6-dimethoxyphenoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 62496011 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-chloro-6-(2,6-dimethoxyphenoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1Oc1c(OC)cccc1OC |
| InChI | InChI=1S/C15H15ClN2O3/c1-19-11-7-4-8-12(20-2)14(11)21-10-6-3-5-9(16)13(10)15(17)18/h3-8H,1-2H3,(H3,17,18) |
| InChIKey | PXVYOYMMDWWIBX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|