C12H18O4 — CID 174975216
propanal;1,2,3-trimethoxybenzene (PubChem CID 174975216) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is propanal;1,2,3-trimethoxybenzene.
| Compound Name | propanal;1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 174975216 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | propanal;1,2,3-trimethoxybenzene |
| SMILES | CCC=O.COc1cccc(OC)c1OC |
| InChI | InChI=1S/C9H12O3.C3H6O/c1-10-7-5-4-6-8(11-2)9(7)12-3;1-2-3-4/h4-6H,1-3H3;3H,2H2,1H3 |
| InChIKey | BJRCIRMVDZLRMY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|