C9H13BF4N2O3 — CID 174894869
azanylidyneazanium;1,2,3-trimethoxybenzene;tetrafluoroborate (PubChem CID 174894869) has the molecular formula C9H13BF4N2O3 and a molecular weight of 284.02 g/mol. Its IUPAC name is azanylidyneazanium;1,2,3-trimethoxybenzene;tetrafluoroborate.
| Compound Name | azanylidyneazanium;1,2,3-trimethoxybenzene;tetrafluoroborate |
|---|---|
| PubChem CID | 174894869 |
| Molecular Formula | C9H13BF4N2O3 |
| Molecular Weight | 284.02 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | azanylidyneazanium;1,2,3-trimethoxybenzene;tetrafluoroborate |
| SMILES | COc1cccc(OC)c1OC.F[B-](F)(F)F.N#[NH+] |
| InChI | InChI=1S/C9H12O3.BF4.N2/c1-10-7-5-4-6-8(11-2)9(7)12-3;2-1(3,4)5;1-2/h4-6H,1-3H3;;/q;-1;/p+1 |
| InChIKey | UOHSJLSNMLTJPQ-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.02 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|