C9H9F3O5S — CID 22096593
(2,3-dimethoxyphenyl) trifluoromethanesulfonate (PubChem CID 22096593) has the molecular formula C9H9F3O5S and a molecular weight of 286.23 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl) trifluoromethanesulfonate.
| Compound Name | (2,3-dimethoxyphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22096593 |
| Molecular Formula | C9H9F3O5S |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | (2,3-dimethoxyphenyl) trifluoromethanesulfonate |
| SMILES | COc1cccc(OS(=O)(=O)C(F)(F)F)c1OC |
| InChI | InChI=1S/C9H9F3O5S/c1-15-6-4-3-5-7(8(6)16-2)17-18(13,14)9(10,11)12/h3-5H,1-2H3 |
| InChIKey | KSUGLDURODGFHB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|