C12H11F3O4S — CID 86018309
(2-but-3-ynyl-6-methoxyphenyl) trifluoromethanesulfonate (PubChem CID 86018309) has the molecular formula C12H11F3O4S and a molecular weight of 308.28 g/mol. Its IUPAC name is (2-but-3-ynyl-6-methoxyphenyl) trifluoromethanesulfonate.
| Compound Name | (2-but-3-ynyl-6-methoxyphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86018309 |
| Molecular Formula | C12H11F3O4S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (2-but-3-ynyl-6-methoxyphenyl) trifluoromethanesulfonate |
| SMILES | C#CCCc1cccc(OC)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O4S/c1-3-4-6-9-7-5-8-10(18-2)11(9)19-20(16,17)12(13,14)15/h1,5,7-8H,4,6H2,2H3 |
| InChIKey | NJXDNZQKVWHATK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|