C11H12O2 — CID 119082494
1,2-dimethoxy-3-prop-2-ynylbenzene (PubChem CID 119082494) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 1,2-dimethoxy-3-prop-2-ynylbenzene.
| Compound Name | 1,2-dimethoxy-3-prop-2-ynylbenzene |
|---|---|
| PubChem CID | 119082494 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1,2-dimethoxy-3-prop-2-ynylbenzene |
| SMILES | C#CCc1cccc(OC)c1OC |
| InChI | InChI=1S/C11H12O2/c1-4-6-9-7-5-8-10(12-2)11(9)13-3/h1,5,7-8H,6H2,2-3H3 |
| InChIKey | JGPGFIGYRCVOAN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|