C12H19NO2 — CID 54776109
3-(2,3-dimethoxyphenyl)-N-methylpropan-1-amine (PubChem CID 54776109) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,3-dimethoxyphenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 54776109 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1cccc(OC)c1OC |
| InChI | InChI=1S/C12H19NO2/c1-13-9-5-7-10-6-4-8-11(14-2)12(10)15-3/h4,6,8,13H,5,7,9H2,1-3H3 |
| InChIKey | YNIYDUUBDZYHLV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|