C13H20N2O3 — CID 163403698
N-[2-[2-(2,3-dimethoxyphenyl)ethylamino]ethyl]formamide (PubChem CID 163403698) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-[2-[2-(2,3-dimethoxyphenyl)ethylamino]ethyl]formamide.
| Compound Name | N-[2-[2-(2,3-dimethoxyphenyl)ethylamino]ethyl]formamide |
|---|---|
| PubChem CID | 163403698 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-[2-[2-(2,3-dimethoxyphenyl)ethylamino]ethyl]formamide |
| SMILES | COc1cccc(CCNCCNC=O)c1OC |
| InChI | InChI=1S/C13H20N2O3/c1-17-12-5-3-4-11(13(12)18-2)6-7-14-8-9-15-10-16/h3-5,10,14H,6-9H2,1-2H3,(H,15,16) |
| InChIKey | WQKLSJABFNLFAS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|