C9H12O5S — CID 174487670
(2,3-dimethoxyphenyl)methanesulfonic acid (PubChem CID 174487670) has the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)methanesulfonic acid.
| Compound Name | (2,3-dimethoxyphenyl)methanesulfonic acid |
|---|---|
| PubChem CID | 174487670 |
| Molecular Formula | C9H12O5S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (2,3-dimethoxyphenyl)methanesulfonic acid |
| SMILES | COc1cccc(CS(=O)(=O)O)c1OC |
| InChI | InChI=1S/C9H12O5S/c1-13-8-5-3-4-7(9(8)14-2)6-15(10,11)12/h3-5H,6H2,1-2H3,(H,10,11,12) |
| InChIKey | YICRNYPBAHYMJA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|