C12H20N2O4S — CID 28732222
N-[2-[(2,3-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide (PubChem CID 28732222) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is N-[2-[(2,3-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2,3-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 28732222 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[2-[(2,3-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide |
| SMILES | COc1cccc(CNCCNS(C)(=O)=O)c1OC |
| InChI | InChI=1S/C12H20N2O4S/c1-17-11-6-4-5-10(12(11)18-2)9-13-7-8-14-19(3,15)16/h4-6,13-14H,7-9H2,1-3H3 |
| InChIKey | WFTDDLOJGJMZCH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|