C12H19ClN2O4S — CID 63627447
N-[2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide (PubChem CID 63627447) has the molecular formula C12H19ClN2O4S and a molecular weight of 322.81 g/mol. Its IUPAC name is N-[2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 63627447 |
| Molecular Formula | C12H19ClN2O4S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[2-[(2-chloro-3,4-dimethoxyphenyl)methylamino]ethyl]methanesulfonamide |
| SMILES | COc1ccc(CNCCNS(C)(=O)=O)c(Cl)c1OC |
| InChI | InChI=1S/C12H19ClN2O4S/c1-18-10-5-4-9(11(13)12(10)19-2)8-14-6-7-15-20(3,16)17/h4-5,14-15H,6-8H2,1-3H3 |
| InChIKey | SWNNRBKLHCKGIE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|