C12H15ClF3NO2 — CID 63625363
N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 63625363) has the molecular formula C12H15ClF3NO2 and a molecular weight of 297.70 g/mol. Its IUPAC name is N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 63625363 |
| Molecular Formula | C12H15ClF3NO2 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | COc1ccc(CNCCC(F)(F)F)c(Cl)c1OC |
| InChI | InChI=1S/C12H15ClF3NO2/c1-18-9-4-3-8(10(13)11(9)19-2)7-17-6-5-12(14,15)16/h3-4,17H,5-7H2,1-2H3 |
| InChIKey | QNEXTTDPPGHPAL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|