C11H16ClNO3 — CID 82710373
1-(2-chloro-3,4-dimethoxyphenyl)-N-ethoxymethanamine (PubChem CID 82710373) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 1-(2-chloro-3,4-dimethoxyphenyl)-N-ethoxymethanamine.
| Compound Name | 1-(2-chloro-3,4-dimethoxyphenyl)-N-ethoxymethanamine |
|---|---|
| PubChem CID | 82710373 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-(2-chloro-3,4-dimethoxyphenyl)-N-ethoxymethanamine |
| SMILES | CCONCc1ccc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C11H16ClNO3/c1-4-16-13-7-8-5-6-9(14-2)11(15-3)10(8)12/h5-6,13H,4,7H2,1-3H3 |
| InChIKey | NBSQWXIJFUOHRM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|