C9H12ClNO3 — CID 117310273
O-[(2-chloro-3,4-dimethoxyphenyl)methyl]hydroxylamine (PubChem CID 117310273) has the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. Its IUPAC name is O-[(2-chloro-3,4-dimethoxyphenyl)methyl]hydroxylamine.
| Compound Name | O-[(2-chloro-3,4-dimethoxyphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117310273 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | O-[(2-chloro-3,4-dimethoxyphenyl)methyl]hydroxylamine |
| SMILES | COc1ccc(CON)c(Cl)c1OC |
| InChI | InChI=1S/C9H12ClNO3/c1-12-7-4-3-6(5-14-11)8(10)9(7)13-2/h3-4H,5,11H2,1-2H3 |
| InChIKey | QECJEIOQDNKGAJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|