C17H26ClNO2 — CID 63626731
N-[(2-chloro-3,4-dimethoxyphenyl)methyl]cyclooctanamine (PubChem CID 63626731) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is N-[(2-chloro-3,4-dimethoxyphenyl)methyl]cyclooctanamine.
| Compound Name | N-[(2-chloro-3,4-dimethoxyphenyl)methyl]cyclooctanamine |
|---|---|
| PubChem CID | 63626731 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[(2-chloro-3,4-dimethoxyphenyl)methyl]cyclooctanamine |
| SMILES | COc1ccc(CNC2CCCCCCC2)c(Cl)c1OC |
| InChI | InChI=1S/C17H26ClNO2/c1-20-15-11-10-13(16(18)17(15)21-2)12-19-14-8-6-4-3-5-7-9-14/h10-11,14,19H,3-9,12H2,1-2H3 |
| InChIKey | ULWWCCXCFITTTO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |