C18H27NO6 — CID 2849724
N-[(2,4-dimethoxy-3-methylphenyl)methyl]cyclohexanamine;oxalic acid (PubChem CID 2849724) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[(2,4-dimethoxy-3-methylphenyl)methyl]cyclohexanamine;oxalic acid.
| Compound Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]cyclohexanamine;oxalic acid |
|---|---|
| PubChem CID | 2849724 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]cyclohexanamine;oxalic acid |
| SMILES | COc1ccc(CNC2CCCCC2)c(OC)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H25NO2.C2H2O4/c1-12-15(18-2)10-9-13(16(12)19-3)11-17-14-7-5-4-6-8-14;3-1(4)2(5)6/h9-10,14,17H,4-8,11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | PESFUXAJKBKMLS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|