C14H16F3NO3 — CID 167855539
(E)-N-[2-(2,3-dimethoxyphenyl)ethyl]-4,4,4-trifluorobut-2-enamide (PubChem CID 167855539) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is (E)-N-[2-(2,3-dimethoxyphenyl)ethyl]-4,4,4-trifluorobut-2-enamide.
| Compound Name | (E)-N-[2-(2,3-dimethoxyphenyl)ethyl]-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 167855539 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (E)-N-[2-(2,3-dimethoxyphenyl)ethyl]-4,4,4-trifluorobut-2-enamide |
| SMILES | COc1cccc(CCNC(=O)/C=C/C(F)(F)F)c1OC |
| InChI | InChI=1S/C14H16F3NO3/c1-20-11-5-3-4-10(13(11)21-2)7-9-18-12(19)6-8-14(15,16)17/h3-6,8H,7,9H2,1-2H3,(H,18,19)/b8-6+ |
| InChIKey | INOGXOVJUJSFGW-SOFGYWHQSA-N |
| XLogP | 2.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|