C20H28O4 — CID 70089547
1,2-dimethoxy-3-[4-(3-methoxyphenyl)butyl]benzene;methanol (PubChem CID 70089547) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1,2-dimethoxy-3-[4-(3-methoxyphenyl)butyl]benzene;methanol.
| Compound Name | 1,2-dimethoxy-3-[4-(3-methoxyphenyl)butyl]benzene;methanol |
|---|---|
| PubChem CID | 70089547 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1,2-dimethoxy-3-[4-(3-methoxyphenyl)butyl]benzene;methanol |
| SMILES | CO.COc1cccc(CCCCc2cccc(OC)c2OC)c1 |
| InChI | InChI=1S/C19H24O3.CH4O/c1-20-17-12-6-9-15(14-17)8-4-5-10-16-11-7-13-18(21-2)19(16)22-3;1-2/h6-7,9,11-14H,4-5,8,10H2,1-3H3;2H,1H3 |
| InChIKey | IJMHBYXORBIOFA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|