C24H26O5 — CID 172870856
4,6-bis[2-(3-methoxyphenyl)ethyl]benzene-1,2,3-triol (PubChem CID 172870856) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4,6-bis[2-(3-methoxyphenyl)ethyl]benzene-1,2,3-triol.
| Compound Name | 4,6-bis[2-(3-methoxyphenyl)ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 172870856 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4,6-bis[2-(3-methoxyphenyl)ethyl]benzene-1,2,3-triol |
| SMILES | COc1cccc(CCc2cc(CCc3cccc(OC)c3)c(O)c(O)c2O)c1 |
| InChI | InChI=1S/C24H26O5/c1-28-20-7-3-5-16(13-20)9-11-18-15-19(23(26)24(27)22(18)25)12-10-17-6-4-8-21(14-17)29-2/h3-8,13-15,25-27H,9-12H2,1-2H3 |
| InChIKey | JABMBNPIWVJFRK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|