C16H18O5 — CID 175822516
3-methoxy-5-[2-(3-methoxyphenyl)ethyl]benzene-1,2,4-triol (PubChem CID 175822516) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-methoxy-5-[2-(3-methoxyphenyl)ethyl]benzene-1,2,4-triol.
| Compound Name | 3-methoxy-5-[2-(3-methoxyphenyl)ethyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 175822516 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-methoxy-5-[2-(3-methoxyphenyl)ethyl]benzene-1,2,4-triol |
| SMILES | COc1cccc(CCc2cc(O)c(O)c(OC)c2O)c1 |
| InChI | InChI=1S/C16H18O5/c1-20-12-5-3-4-10(8-12)6-7-11-9-13(17)15(19)16(21-2)14(11)18/h3-5,8-9,17-19H,6-7H2,1-2H3 |
| InChIKey | HRVUGCNISBUERN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|