C13H13F3O9S — CID 11974867
dimethyl 4,6-dimethoxy-2-(trifluoromethylsulfonyloxy)benzene-1,3-dicarboxylate (PubChem CID 11974867) has the molecular formula C13H13F3O9S and a molecular weight of 402.30 g/mol. Its IUPAC name is dimethyl 4,6-dimethoxy-2-(trifluoromethylsulfonyloxy)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4,6-dimethoxy-2-(trifluoromethylsulfonyloxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11974867 |
| Molecular Formula | C13H13F3O9S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | dimethyl 4,6-dimethoxy-2-(trifluoromethylsulfonyloxy)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1c(OC)cc(OC)c(C(=O)OC)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O9S/c1-21-6-5-7(22-2)9(12(18)24-4)10(8(6)11(17)23-3)25-26(19,20)13(14,15)16/h5H,1-4H3 |
| InChIKey | SLSQOWUCBILDQR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|