C16H19F3O8S — CID 142968349
methyl 2,3-dimethyl-6-prop-2-enoxy-4-(trifluoromethylsulfonyloxy)benzoate;methyl formate (PubChem CID 142968349) has the molecular formula C16H19F3O8S and a molecular weight of 428.38 g/mol. Its IUPAC name is methyl 2,3-dimethyl-6-prop-2-enoxy-4-(trifluoromethylsulfonyloxy)benzoate;methyl formate.
| Compound Name | methyl 2,3-dimethyl-6-prop-2-enoxy-4-(trifluoromethylsulfonyloxy)benzoate;methyl formate |
|---|---|
| PubChem CID | 142968349 |
| Molecular Formula | C16H19F3O8S |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | methyl 2,3-dimethyl-6-prop-2-enoxy-4-(trifluoromethylsulfonyloxy)benzoate;methyl formate |
| SMILES | C=CCOc1cc(OS(=O)(=O)C(F)(F)F)c(C)c(C)c1C(=O)OC.COC=O |
| InChI | InChI=1S/C14H15F3O6S.C2H4O2/c1-5-6-22-11-7-10(23-24(19,20)14(15,16)17)8(2)9(3)12(11)13(18)21-4;1-4-2-3/h5,7H,1,6H2,2-4H3;2H,1H3 |
| InChIKey | AIDWGZUZGMDOIE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|