C19H19F3O8S — CID 162008092
methyl 2-hydroxy-4-methylbenzoate;methyl 4-methyl-2-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 162008092) has the molecular formula C19H19F3O8S and a molecular weight of 464.41 g/mol. Its IUPAC name is methyl 2-hydroxy-4-methylbenzoate;methyl 4-methyl-2-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | methyl 2-hydroxy-4-methylbenzoate;methyl 4-methyl-2-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 162008092 |
| Molecular Formula | C19H19F3O8S |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | methyl 2-hydroxy-4-methylbenzoate;methyl 4-methyl-2-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1ccc(C)cc1O.COC(=O)c1ccc(C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O5S.C9H10O3/c1-6-3-4-7(9(14)17-2)8(5-6)18-19(15,16)10(11,12)13;1-6-3-4-7(8(10)5-6)9(11)12-2/h3-5H,1-2H3;3-5,10H,1-2H3 |
| InChIKey | YTCLHYHSCKYLIE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|