C11H8ClF3O7S — CID 126601709
dimethyl 2-chloro-3-(trifluoromethylsulfonyloxy)benzene-1,4-dicarboxylate (PubChem CID 126601709) has the molecular formula C11H8ClF3O7S and a molecular weight of 376.69 g/mol. Its IUPAC name is dimethyl 2-chloro-3-(trifluoromethylsulfonyloxy)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-chloro-3-(trifluoromethylsulfonyloxy)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 126601709 |
| Molecular Formula | C11H8ClF3O7S |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | dimethyl 2-chloro-3-(trifluoromethylsulfonyloxy)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(OS(=O)(=O)C(F)(F)F)c1Cl |
| InChI | InChI=1S/C11H8ClF3O7S/c1-20-9(16)5-3-4-6(10(17)21-2)8(7(5)12)22-23(18,19)11(13,14)15/h3-4H,1-2H3 |
| InChIKey | WLZSSJZKTNBFCO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|