methyl 2,3-dichloro-4-iodobenzoate

C8H5Cl2IO2 — CID 134104394

IUPACmethyl 2,3-dichloro-4-iodobenzoate
SMILESCOC(=O)c1ccc(I)c(Cl)c1Cl
InChIInChI=1S/C8H5Cl2IO2/c1-13-8(12)4-2-3-5(11)7(10)6(4)9/h2-3H,1H3
InChIKeyFWQURFYRLXZUBM-UHFFFAOYSA-N
MW330.94 g/mol
LogP3.38
Rot. Bonds1

About methyl 2,3-dichloro-4-iodobenzoate

methyl 2,3-dichloro-4-iodobenzoate (PubChem CID 134104394) has the molecular formula C8H5Cl2IO2 and a molecular weight of 330.94 g/mol. Its IUPAC name is methyl 2,3-dichloro-4-iodobenzoate.

Molecular Properties

Compound Namemethyl 2,3-dichloro-4-iodobenzoate
PubChem CID134104394
Molecular FormulaC8H5Cl2IO2
Molecular Weight330.94 g/mol
Exact Mass329.87
IUPAC Namemethyl 2,3-dichloro-4-iodobenzoate
SMILESCOC(=O)c1ccc(I)c(Cl)c1Cl
InChIInChI=1S/C8H5Cl2IO2/c1-13-8(12)4-2-3-5(11)7(10)6(4)9/h2-3H,1H3
InChIKeyFWQURFYRLXZUBM-UHFFFAOYSA-N
XLogP3.38
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.94
LogP ≤ 53.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 2,3-dichloro-4-iodobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-dichloro-4-iodobenzoate?
The IUPAC name of methyl 2,3-dichloro-4-iodobenzoate (CID 134104394) is methyl 2,3-dichloro-4-iodobenzoate.
What is the SMILES notation for methyl 2,3-dichloro-4-iodobenzoate?
The canonical SMILES for methyl 2,3-dichloro-4-iodobenzoate is COC(=O)c1ccc(I)c(Cl)c1Cl.
What is the InChIKey of methyl 2,3-dichloro-4-iodobenzoate?
The InChIKey is FWQURFYRLXZUBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2IO2/c1-13-8(12)4-2-3-5(11)7(10)6(4)9/h2-3H,1H3.
What are the key properties of methyl 2,3-dichloro-4-iodobenzoate?
methyl 2,3-dichloro-4-iodobenzoate has a molecular weight of 330.94 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dichloro-4-iodobenzoate is sourced from PubChem (CID 134104394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).