C8H5Cl2FO2 — CID 121228328
methyl 2,4-dichloro-3-fluorobenzoate (PubChem CID 121228328) has the molecular formula C8H5Cl2FO2 and a molecular weight of 223.03 g/mol. Its IUPAC name is methyl 2,4-dichloro-3-fluorobenzoate.
| Compound Name | methyl 2,4-dichloro-3-fluorobenzoate |
|---|---|
| PubChem CID | 121228328 |
| Molecular Formula | C8H5Cl2FO2 |
| Molecular Weight | 223.03 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | methyl 2,4-dichloro-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C8H5Cl2FO2/c1-13-8(12)4-2-3-5(9)7(11)6(4)10/h2-3H,1H3 |
| InChIKey | XXQCEIDMMAQXAF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.03 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|