C14H5Cl5F3NO2 — CID 134635581
methyl 6-(2,3,4,5,6-pentachlorophenyl)-2-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 134635581) has the molecular formula C14H5Cl5F3NO2 and a molecular weight of 453.46 g/mol. Its IUPAC name is methyl 6-(2,3,4,5,6-pentachlorophenyl)-2-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-(2,3,4,5,6-pentachlorophenyl)-2-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134635581 |
| Molecular Formula | C14H5Cl5F3NO2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 450.87 |
| IUPAC Name | methyl 6-(2,3,4,5,6-pentachlorophenyl)-2-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C14H5Cl5F3NO2/c1-25-13(24)4-2-3-5(23-12(4)14(20,21)22)6-7(15)9(17)11(19)10(18)8(6)16/h2-3H,1H3 |
| InChIKey | IXPCIELBEXWXTJ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|