C13H5Cl6NO2 — CID 134637790
methyl 6-chloro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylate (PubChem CID 134637790) has the molecular formula C13H5Cl6NO2 and a molecular weight of 419.91 g/mol. Its IUPAC name is methyl 6-chloro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134637790 |
| Molecular Formula | C13H5Cl6NO2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 416.85 |
| IUPAC Name | methyl 6-chloro-2-(2,3,4,5,6-pentachlorophenyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)nc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl6NO2/c1-22-13(21)4-2-3-5(14)20-12(4)6-7(15)9(17)11(19)10(18)8(6)16/h2-3H,1H3 |
| InChIKey | HGORNVAACUBZCC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|