C19H5Cl10NO2 — CID 134635394
methyl 5,6-bis(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylate (PubChem CID 134635394) has the molecular formula C19H5Cl10NO2 and a molecular weight of 633.78 g/mol. Its IUPAC name is methyl 5,6-bis(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylate.
| Compound Name | methyl 5,6-bis(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134635394 |
| Molecular Formula | C19H5Cl10NO2 |
| Molecular Weight | 633.78 g/mol |
| Exact Mass | 628.72 |
| IUPAC Name | methyl 5,6-bis(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C19H5Cl10NO2/c1-32-19(31)5-3-2-4(6-8(20)12(24)16(28)13(25)9(6)21)18(30-5)7-10(22)14(26)17(29)15(27)11(7)23/h2-3H,1H3 |
| InChIKey | IXTSVBIVGCGGIV-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.78 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|