C14H10Cl3NO3 — CID 134636682
methyl 6-methoxy-5-(2,3,4-trichlorophenyl)pyridine-2-carboxylate (PubChem CID 134636682) has the molecular formula C14H10Cl3NO3 and a molecular weight of 346.60 g/mol. Its IUPAC name is methyl 6-methoxy-5-(2,3,4-trichlorophenyl)pyridine-2-carboxylate.
| Compound Name | methyl 6-methoxy-5-(2,3,4-trichlorophenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134636682 |
| Molecular Formula | C14H10Cl3NO3 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | methyl 6-methoxy-5-(2,3,4-trichlorophenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2ccc(Cl)c(Cl)c2Cl)c(OC)n1 |
| InChI | InChI=1S/C14H10Cl3NO3/c1-20-13-8(4-6-10(18-13)14(19)21-2)7-3-5-9(15)12(17)11(7)16/h3-6H,1-2H3 |
| InChIKey | NGKMGRKLUCQGKA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|