C16H12Cl3N3O2 — CID 22388013
methyl 2-methyl-1-[(2,3,4-trichlorophenyl)methyl]imidazo[4,5-b]pyridine-5-carboxylate (PubChem CID 22388013) has the molecular formula C16H12Cl3N3O2 and a molecular weight of 384.65 g/mol. Its IUPAC name is methyl 2-methyl-1-[(2,3,4-trichlorophenyl)methyl]imidazo[4,5-b]pyridine-5-carboxylate.
| Compound Name | methyl 2-methyl-1-[(2,3,4-trichlorophenyl)methyl]imidazo[4,5-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 22388013 |
| Molecular Formula | C16H12Cl3N3O2 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | methyl 2-methyl-1-[(2,3,4-trichlorophenyl)methyl]imidazo[4,5-b]pyridine-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)nc(C)n2Cc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl3N3O2/c1-8-20-15-12(6-5-11(21-15)16(23)24-2)22(8)7-9-3-4-10(17)14(19)13(9)18/h3-6H,7H2,1-2H3 |
| InChIKey | XXOIXOQPNCXXHZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|