methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate

C13H10Cl2N2O3 — CID 114408812

IUPACmethyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(N)c(Oc2ccc(Cl)c(Cl)c2)n1
InChIInChI=1S/C13H10Cl2N2O3/c1-19-13(18)11-5-4-10(16)12(17-11)20-7-2-3-8(14)9(15)6-7/h2-6H,16H2,1H3
InChIKeyUTOUPCPMLPSIKW-UHFFFAOYSA-N
MW313.14 g/mol
LogP3.55
Rot. Bonds3

About methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate

methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate (PubChem CID 114408812) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate
PubChem CID114408812
Molecular FormulaC13H10Cl2N2O3
Molecular Weight313.14 g/mol
Exact Mass312.01
IUPAC Namemethyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate
SMILESCOC(=O)c1ccc(N)c(Oc2ccc(Cl)c(Cl)c2)n1
InChIInChI=1S/C13H10Cl2N2O3/c1-19-13(18)11-5-4-10(16)12(17-11)20-7-2-3-8(14)9(15)6-7/h2-6H,16H2,1H3
InChIKeyUTOUPCPMLPSIKW-UHFFFAOYSA-N
XLogP3.55
TPSA74.44 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.14
LogP ≤ 53.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate?
The IUPAC name of methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate (CID 114408812) is methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate?
The canonical SMILES for methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate is COC(=O)c1ccc(N)c(Oc2ccc(Cl)c(Cl)c2)n1.
What is the InChIKey of methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate?
The InChIKey is UTOUPCPMLPSIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O3/c1-19-13(18)11-5-4-10(16)12(17-11)20-7-2-3-8(14)9(15)6-7/h2-6H,16H2,1H3.
What are the key properties of methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate?
methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate has a molecular weight of 313.14 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate is sourced from PubChem (CID 114408812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).