C13H10Cl2N2O3 — CID 114408812
methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate (PubChem CID 114408812) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114408812 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | methyl 5-amino-6-(3,4-dichlorophenoxy)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(Oc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H10Cl2N2O3/c1-19-13(18)11-5-4-10(16)12(17-11)20-7-2-3-8(14)9(15)6-7/h2-6H,16H2,1H3 |
| InChIKey | UTOUPCPMLPSIKW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |