C13H11ClFN3O2 — CID 107531028
methyl 5-amino-6-(2-chloro-5-fluoroanilino)pyridine-2-carboxylate (PubChem CID 107531028) has the molecular formula C13H11ClFN3O2 and a molecular weight of 295.70 g/mol. Its IUPAC name is methyl 5-amino-6-(2-chloro-5-fluoroanilino)pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-(2-chloro-5-fluoroanilino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 107531028 |
| Molecular Formula | C13H11ClFN3O2 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | methyl 5-amino-6-(2-chloro-5-fluoroanilino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(Nc2cc(F)ccc2Cl)n1 |
| InChI | InChI=1S/C13H11ClFN3O2/c1-20-13(19)10-5-4-9(16)12(17-10)18-11-6-7(15)2-3-8(11)14/h2-6H,16H2,1H3,(H,17,18) |
| InChIKey | BGTAPPBSAKIBRS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |