C14H13BrFN3O2 — CID 107593608
methyl 5-amino-6-(5-bromo-4-fluoro-2-methylanilino)pyridine-2-carboxylate (PubChem CID 107593608) has the molecular formula C14H13BrFN3O2 and a molecular weight of 354.18 g/mol. Its IUPAC name is methyl 5-amino-6-(5-bromo-4-fluoro-2-methylanilino)pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-(5-bromo-4-fluoro-2-methylanilino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 107593608 |
| Molecular Formula | C14H13BrFN3O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | methyl 5-amino-6-(5-bromo-4-fluoro-2-methylanilino)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(Nc2cc(Br)c(F)cc2C)n1 |
| InChI | InChI=1S/C14H13BrFN3O2/c1-7-5-9(16)8(15)6-12(7)19-13-10(17)3-4-11(18-13)14(20)21-2/h3-6H,17H2,1-2H3,(H,18,19) |
| InChIKey | HOGHBKUCTHPXIB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |