C12H9BrF2N4O — CID 102854816
5-amino-6-(5-bromo-2,4-difluoroanilino)pyridine-2-carboxamide (PubChem CID 102854816) has the molecular formula C12H9BrF2N4O and a molecular weight of 343.13 g/mol. Its IUPAC name is 5-amino-6-(5-bromo-2,4-difluoroanilino)pyridine-2-carboxamide.
| Compound Name | 5-amino-6-(5-bromo-2,4-difluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 102854816 |
| Molecular Formula | C12H9BrF2N4O |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 5-amino-6-(5-bromo-2,4-difluoroanilino)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(N)c(Nc2cc(Br)c(F)cc2F)n1 |
| InChI | InChI=1S/C12H9BrF2N4O/c13-5-3-10(7(15)4-6(5)14)19-12-8(16)1-2-9(18-12)11(17)20/h1-4H,16H2,(H2,17,20)(H,18,19) |
| InChIKey | OKXMKLAWVNIKSB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|