C12H11FN4O2 — CID 114254932
methyl 5-amino-6-[(5-fluoro-3-pyridinyl)amino]pyridine-2-carboxylate (PubChem CID 114254932) has the molecular formula C12H11FN4O2 and a molecular weight of 262.24 g/mol. Its IUPAC name is methyl 5-amino-6-[(5-fluoro-3-pyridinyl)amino]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[(5-fluoro-3-pyridinyl)amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114254932 |
| Molecular Formula | C12H11FN4O2 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | methyl 5-amino-6-[(5-fluoro-3-pyridinyl)amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(Nc2cncc(F)c2)n1 |
| InChI | InChI=1S/C12H11FN4O2/c1-19-12(18)10-3-2-9(14)11(17-10)16-8-4-7(13)5-15-6-8/h2-6H,14H2,1H3,(H,16,17) |
| InChIKey | UZKYXJPXSYMEEA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |